What is the common name of propane-1 2 3-tricarboxylic acid?
Table of Contents
What is the common name of propane-1 2 3-tricarboxylic acid?
tricarballylic acid
Propane-1,2,3-tricarboxylic acid, also known as tricarballylic acid, carballylic acid, and β-carboxyglutaric acid, is a tricarboxylic acid.
What is the structure of propane-1 2 3-tricarboxylic acid?
C6H8O6
Propane-1,2,3-tricarboxylic acid/Formula
Which of the following is pentane 1/5 dioic acid?
Amino-4-(4,4-diphenylbut-1-yl)pentane-1,5-dioic acid | C21H25NO4 – PubChem.
What is the common name of tricarboxylic acid?
Examples
| Common name | IUPAC name | Molecular formula |
|---|---|---|
| Isocitric acid | 1-hydroxypropane-1,2,3-tricarboxylic acid | C6H8O7 |
| Aconitic acid | Prop-1-ene-1,2,3-tricarboxylic acid | C6H6O6 |
| Propane-1,2,3-tricarboxylic acid | Propane-1,2,3-tricarboxylic acid | C3H5(COOH)3 |
| Agaric acid | 2-Hydroxynonadecane-1,2,3-tricarboxylic acid | C22H40O7 |
How do you name tricarboxylic acid?
If an unbranched chain is directly linked to more than two carboxy groups, these carboxy groups are named from the parent hydride by substitutive use of a suffix such as “-tricarboxylic acid”, etc. Other carboxylic acids are named by adding the suffix “-carboxylic acid” to the name of a parent hydride.
Is citric acid a tricarboxylic acid?
Citric acid is a six-carbon tricarboxylic acid, which was first isolated from lemon juice.
What is the structure of pentane 1/4 diol?
pentane-1,4-diol
| Compound number: | MolPort-003-927-486 |
|---|---|
| IUPAC traditional: | 1,4-dihydroxypentane |
| SMILES: | CC(O)CCCO |
| InChI key: | GLOBUAZSRIOKLN-UHFFFAOYSA-N |
| Molecular formula: | C5H12O2 |
What is the Iupac name of glutaric acid?
pentanedioic acid
| IUPAC Name | pentanedioic acid |
|---|---|
| Alternative Names | GLUTARIC ACID Pentanedioic acid 1,5-Pentanedioic acid 1,3-Propanedicarboxylic acid Pentandioic acid |
| Molecular Formula | C5H8O4 |
| Molar Mass | 132.115 g/mol |
| InChI | InChI=1S/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9) |
Which of the following is a tricarboxylic acid *?
(A)Citric acid: As we can see that this compound carries 3 carboxyl groups (C(=O)OH) attached to the parent chain. Hence this is a tricarboxylic acid. Citric acid is a weak acid which naturally occurs in citric fruits.
Which is the qualitative test for the esters?
ferric hydroxamate test
One test for esters is the ferric hydroxamate test whereby the ester is converted to a hydroxamic acid (HOHN-C=O) which will give a positive ferric chloride test.