What is the structural formula of Cinnamaldehyde?
Table of Contents [hide]
What is the structural formula of Cinnamaldehyde?
C9H8O
Cinnamaldehyde/Formula
What is the Iupac name of molecule?
IUPAC nomenclature is based on naming a molecule’s longest chain of carbons connected by single bonds, whether in a continuous chain or in a ring. All deviations, either multiple bonds or atoms other than carbon and hydrogen, are indicated by prefixes or suffixes according to a specific set of priorities.
What is the Iupac name of crotonaldehyde?
Crotonaldehyde
Names | |
---|---|
IUPAC name (2E)-but-2-enal | |
Other names Crotonaldehyde Crotoinic aldehyde β-Methacrolein β-Methyl acrolein 2-butenal Propylene aldehyde | |
Identifiers | |
CAS Number | 4170-30-3 (E/Z) 123-73-9 (E) 15798-64-8 (Z) |
What is the Iupac name of cinnamic acid?
IUPAC Name | (E)-3-phenylprop-2-enoic acid |
---|---|
Alternative Names | CINNAMIC ACID TRANS-CINNAMIC ACID (E)-Cinnamic acid 3-Phenylacrylic acid trans-3-Phenylacrylic acid |
Molecular Formula | C9H8O2 |
Molar Mass | 148.161 g/mol |
InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
What is the Iupac name of vanillin?
4-hydroxy-3-methoxybenzaldehyde
IUPAC Name | 4-hydroxy-3-methoxybenzaldehyde |
---|---|
Alternative Names | vanillin 4-Hydroxy-3-methoxybenzaldehyde Vanillaldehyde Vanillic aldehyde 2-Methoxy-4-formylphenol |
Molecular Formula | C8H8O3 |
Molar Mass | 152.149 g/mol |
InChI | InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3 |
What is the Iupac name of ether?
Systematic (IUPAC) names for ethers use the more complex group as the root name, with the oxygen atom and the smaller group named as an alkoxy substituent. Examples given above are ethoxyethane (diethyl ether), methoxyethane (methyl ethyl ether), 2-methoxy-2-methylpropane (MTBE), and phenoxybenzene (diphenyl ether).