What is the structural formula of Cinnamaldehyde?

C9H8O
Cinnamaldehyde/Formula

What is the Iupac name of molecule?

IUPAC nomenclature is based on naming a molecule’s longest chain of carbons connected by single bonds, whether in a continuous chain or in a ring. All deviations, either multiple bonds or atoms other than carbon and hydrogen, are indicated by prefixes or suffixes according to a specific set of priorities.

What is the Iupac name of crotonaldehyde?

Crotonaldehyde

Names
IUPAC name (2E)-but-2-enal
Other names Crotonaldehyde Crotoinic aldehyde β-Methacrolein β-Methyl acrolein 2-butenal Propylene aldehyde
Identifiers
CAS Number	4170-30-3 (E/Z) 123-73-9 (E) 15798-64-8 (Z)

What is the Iupac name of cinnamic acid?

IUPAC Name	(E)-3-phenylprop-2-enoic acid
Alternative Names	CINNAMIC ACID TRANS-CINNAMIC ACID (E)-Cinnamic acid 3-Phenylacrylic acid trans-3-Phenylacrylic acid
Molecular Formula	C9H8O2
Molar Mass	148.161 g/mol
InChI	InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+

What is the Iupac name of vanillin?

4-hydroxy-3-methoxybenzaldehyde

IUPAC Name	4-hydroxy-3-methoxybenzaldehyde
Alternative Names	vanillin 4-Hydroxy-3-methoxybenzaldehyde Vanillaldehyde Vanillic aldehyde 2-Methoxy-4-formylphenol
Molecular Formula	C8H8O3
Molar Mass	152.149 g/mol
InChI	InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3

What is the Iupac name of ether?

Systematic (IUPAC) names for ethers use the more complex group as the root name, with the oxygen atom and the smaller group named as an alkoxy substituent. Examples given above are ethoxyethane (diethyl ether), methoxyethane (methyl ethyl ether), 2-methoxy-2-methylpropane (MTBE), and phenoxybenzene (diphenyl ether).